{ "run_id": "2026-04-20T10-41-50", "timestamp": "2026-04-20T10:41:50.717942+00:00", "samples": 2, "prompts": { "logic-1": { "prompt": "If all bloops are razzies and all razzies are lazzies, are all bloops lazzies?", "category": "logic", "responses": { "openai/gpt-5.4": [ { "content": "Yes.\n\nIf:\n- all bloops are razzies, and\n- all razzies are lazzies,\n\nthen bloops are a subset of razzies, and razzies are a subset of lazzies. So all bloops must also be lazzies.", "latency_ms": 2684, "input_tokens": 46, "output_tokens": 62 }, { "content": "Yes.\n\nIf:\n- All bloops are razzies\n- All razzies are lazzies\n\nThen bloops are a subset of razzies, and razzies are a subset of lazzies, so all bloops are lazzies.", "latency_ms": 1500, "input_tokens": 46, "output_tokens": 58 } ], "openai/gpt-5.4-mini": [ { "content": "Yes. If all bloops are razzies, and all razzies are lazzies, then every bloop is a razzie and therefore also a lazzy. So all bloops are lazzies.", "latency_ms": 1700, "input_tokens": 46, "output_tokens": 48 }, { "content": "Yes. If all bloops are razzies, and all razzies are lazzies, then every bloop is a razzie and therefore also a lazzy. So **all bloops are lazzies**.", "latency_ms": 750, "input_tokens": 46, "output_tokens": 50 } ], "anthropic/claude-opus-4-6": [ { "content": "# Step-by-step reasoning:\n\n1. **All bloops are razzies.** This means every bloop is a member of the set of razzies.\n\n2. **All razzies are lazzies.** This means every razzy is a member of the set of lazzies.\n\n3. Since every bloop is a razzy, and every razzy is a lazzy, then every bloop must also be a lazzy.\n\nThis is a classic **syllogism** (transitive relationship):\n\n**Bloops \u2286 Razzies \u2286 Lazzies \u2192 Bloops \u2286 Lazzies**\n\n## Yes, all bloops are definitely lazzies.", "latency_ms": 4306, "input_tokens": 44, "output_tokens": 167 }, { "content": "## Step-by-Step Reasoning\n\n1. **All bloops are razzies.** This means every bloop is a member of the set of razzies.\n\n2. **All razzies are lazzies.** This means every razzie is a member of the set of lazzies.\n\n3. **Combining these:** If every bloop is a razzie, and every razzie is a lazzie, then every bloop must also be a lazzie.\n\nThis is a classic example of a **syllogism** (transitive reasoning):\n\n> Bloops \u2286 Razzies \u2286 Lazzies \u2192 Bloops \u2286 Lazzies\n\n## Answer\n\n**Yes**, all bloops are lazzies.", "latency_ms": 4449, "input_tokens": 44, "output_tokens": 176 } ], "anthropic/claude-sonnet-4-6": [ { "content": "## Step-by-Step Reasoning:\n\n1. **Premise 1:** All bloops are razzies.\n2. **Premise 2:** All razzies are lazzies.\n3. **Conclusion:** Since every bloop is a razzie, and every razzie is a lazzie, then every bloop must also be a lazzie.\n\n**Yes**, all bloops are lazzies. This is a straightforward application of the **transitive property** of logic (syllogism): if A \u2192 B and B \u2192 C, then A \u2192 C.", "latency_ms": 3437, "input_tokens": 44, "output_tokens": 129 }, { "content": "## Step-by-Step Reasoning\n\n1. **Premise 1:** All bloops are razzies.\n2. **Premise 2:** All razzies are lazzies.\n3. **Conclusion:** Since every bloop is a razzie, and every razzie is a lazzie, then every bloop must also be a lazzie.\n\n**Yes**, \u2014 all bloops are lazzies. This follows from the **transitive property** of logic: if A \u2192 B and B \u2192 C, then A \u2192 C.", "latency_ms": 2934, "input_tokens": 44, "output_tokens": 121 } ], "anthropic/claude-haiku-4-5": [ { "content": "# Step-by-step analysis:\n\n1. **Given:** All bloops are razzies\n - This means: If something is a bloop \u2192 it is a razzie\n\n2. **Given:** All razzies are lazzies\n - This means: If something is a razzie \u2192 it is a lazzie\n\n3. **Apply logical chain:**\n - If something is a bloop \u2192 it is a razzie (from statement 1)\n - If it is a razzie \u2192 it is a lazzie (from statement 2)\n - Therefore: If something is a bloop \u2192 it is a lazzie\n\n**Answer: Yes, all bloops are lazzies.**\n\nThis follows the transitive property of logical inclusion: if A \u2286 B and B \u2286 C, then A \u2286 C.", "latency_ms": 5155, "input_tokens": 43, "output_tokens": 192 }, { "content": "# Yes, all bloops are lazzies.\n\nHere's the logical reasoning:\n\n1. All bloops are razzies (given)\n2. All razzies are lazzies (given)\n3. Therefore, all bloops are lazzies (by transitivity)\n\nThis follows the logical principle of **transitive property**: if A\u2192B and B\u2192C, then A\u2192C.\n\nIn this case:\n- bloops \u2192 razzies \u2192 lazzies\n- So: bloops \u2192 lazzies", "latency_ms": 1383, "input_tokens": 43, "output_tokens": 118 } ], "gemini/gemini-2.5-pro": [ { "content": "Yes, all bloops are lazzies.\n\nHere's the step-by-step logic:\n\n1. **Premise 1:** All bloops are razzies. (This means the entire group of \"bloops\" fits inside the group of \"razzies.\")\n2. **Premise 2:** All razzies are lazzies. (This means the entire group of \"razzies\" fits inside the group of \"lazzies.\")\n\nSince the \"bloops\" group is completely inside the \"razzies\" group, and the \"razzies\" group is completely inside the \"lazzies\" group, it logically follows that the \"bloops\" group must also be completely inside the \"lazzies\" group.", "latency_ms": 7281, "input_tokens": 37, "output_tokens": 882 }, { "content": "Yes.\n\nThis is a classic example of a logical syllogism. Let's break it down:\n\n1. **Premise 1:** All bloops are razzies. (This means if something is a bloop, it must also be a razzy).\n2. **Premise 2:** All razzies are lazzies. (This means if something is a razzy, it must also be a lazzy).\n\nSince every single bloop is a razzy, and every single razzy is a lazzy, it logically follows that **all bloops are lazzies**.\n\nThink of it with a real-world example:\n* All poodles are dogs. (Bloops = Poodles, Razzies = Dogs)\n* All dogs are mammals. (Razzies = Dogs, Lazzies = Mammals)\n* Therefore, all poodles are mammals. (All bloops are lazzies).", "latency_ms": 8261, "input_tokens": 37, "output_tokens": 948 } ], "gemini/gemini-2.5-flash": [ { "content": "Yes!\n\nHere's why:\n\n1. **All bloops are razzies** means that every single bloop is also a razzy.\n2. **All razzies are lazzies** means that every single razzy (including all the ones that are also bloops) is also a lazzy.\n\nTherefore, if something is a bloop, it must first be a razzy, and because it's a razzy, it must also be a lazzy. So, all bloops are lazzies.", "latency_ms": 3087, "input_tokens": 37, "output_tokens": 534 }, { "content": "Yes, all bloops are lazzies.\n\nHere's why:\n\n1. **All bloops are razzies:** This means if you have a bloop, it automatically falls into the category of razzies.\n2. **All razzies are lazzies:** This means if you have a razzie (and we know all bloops are razzies), it automatically falls into the category of lazzies.\n\nTherefore, since every bloop is a razzie, and every razzie is a lazzie, it logically follows that every bloop must be a lazzie.", "latency_ms": 2819, "input_tokens": 37, "output_tokens": 441 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "math-1": { "prompt": "A bat and a ball cost $1.10 together. The bat costs $1 more than the ball. How much does the ball cost?", "category": "math", "responses": { "openai/gpt-5.4": [ { "content": "The ball costs **$0.05**.\n\nReasoning:\n- Let the ball cost **x**\n- Then the bat costs **x + $1.00**\n- Together: \n **x + (x + 1.00) = 1.10**\n- So: \n **2x + 1.00 = 1.10**\n- **2x = 0.10**\n- **x = 0.05**\n\nSo the **ball = 5 cents**.", "latency_ms": 2032, "input_tokens": 49, "output_tokens": 107 }, { "content": "Let the ball cost **x** dollars.\n\nThen the bat costs **x + 1.00** dollars.\n\nSo:\n**x + (x + 1.00) = 1.10**\n\nCombine like terms:\n**2x + 1.00 = 1.10**\n\nSubtract 1.00:\n**2x = 0.10**\n\nDivide by 2:\n**x = 0.05**\n\nSo, **the ball costs 5 cents**.", "latency_ms": 2068, "input_tokens": 49, "output_tokens": 102 } ], "openai/gpt-5.4-mini": [ { "content": "Let the ball cost **x** dollars. \nThen the bat costs **x + 1** dollars.\n\nTogether:\n**x + (x + 1) = 1.10**\n\nSo:\n**2x + 1 = 1.10** \n**2x = 0.10** \n**x = 0.05**\n\nSo, the **ball costs $0.05**.", "latency_ms": 894, "input_tokens": 49, "output_tokens": 87 }, { "content": "Let the ball cost \\(x\\) dollars. Then the bat costs \\(x + 1.00\\).\n\nSo:\n\n\\[\nx + (x + 1.00) = 1.10\n\\]\n\n\\[\n2x + 1.00 = 1.10\n\\]\n\n\\[\n2x = 0.10\n\\]\n\n\\[\nx = 0.05\n\\]\n\nSo the ball costs **$0.05**.", "latency_ms": 815, "input_tokens": 49, "output_tokens": 99 } ], "anthropic/claude-opus-4-6": [ { "content": "# The Bat and Ball Problem\n\nLet me work through this step by step.\n\n**Setting up the equation:**\n\nLet the ball cost **x** dollars.\n\nThe bat costs **$1 more** than the ball, so the bat costs **x + $1.00**.\n\nTogether they cost $1.10:\n\n$$x + (x + 1.00) = 1.10$$\n\n**Solving:**\n\n$$2x + 1.00 = 1.10$$\n$$2x = 0.10$$\n$$x = 0.05$$\n\n## The ball costs **$0.05** (5 cents).\n\n**Verification:** The bat costs $1.05, the ball costs $0.05.\n- Difference: $1.05 \u2212 $0.05 = **$1.00** \u2713\n- Total: $1.05 + $0.05 = **$1.10** \u2713\n\n> **Note:** The intuitive answer many people jump to is $0.10, but that would make the bat $1.10 and the total $1.20 \u2014 which is too much!", "latency_ms": 5186, "input_tokens": 49, "output_tokens": 262 }, { "content": "# The Bat and Ball Problem\n\nLet me work through this step by step.\n\n**Setting up the equation:**\n\nLet the ball cost **x** dollars.\n\nThe bat costs **$1 more** than the ball, so the bat costs **x + $1.00**.\n\nTogether they cost $1.10:\n\n$$x + (x + 1.00) = 1.10$$\n\n**Solving:**\n\n$$2x + 1.00 = 1.10$$\n$$2x = 0.10$$\n$$x = 0.05$$\n\n## The ball costs **$0.05** (5 cents).\n\n**Verification:** The bat costs $1.05, the ball costs $0.05.\n- Difference: $1.05 \u2212 $0.05 = **$1.00** \u2713\n- Total: $1.05 + $0.05 = **$1.10** \u2713\n\n> **Note:** The intuitive answer many people jump to is $0.10, but that's incorrect\u2014if the ball were $0.10, the bat would be $1.10, and the total would be $1.20.", "latency_ms": 6121, "input_tokens": 49, "output_tokens": 270 } ], "anthropic/claude-sonnet-4-6": [ { "content": "## Solving the Bat and Ball Problem\n\nLet me define variables and set up equations.\n\n**Let:**\n- Ball = x\n- Bat = y\n\n**Equations:**\n1. x + y = $1.10 (together they cost $1.10)\n2. y = x + $1.00 (bat costs $1 more than the ball)\n\n**Substituting equation 2 into equation 1:**\n\nx + (x + $1.00) = $1.10\n\n2x + $1.00 = $1.10\n\n2x = $0.10\n\nx = **$0.05**\n\n## Answer\n\nThe ball costs **$0.05 (5 cents)**.\n\n*(The bat costs $1.05, and together they cost $1.10 \u2713)*\n\n> **Note:** The intuitive answer of $0.10 is a common mistake \u2014 if the ball cost $0.10, the bat would cost $1.10, and together they'd cost $1.20, not $1.10.", "latency_ms": 4549, "input_tokens": 49, "output_tokens": 243 }, { "content": "## Setting Up the Problem\n\nLet me define variables:\n- Let **b** = cost of the ball\n- Let **bat** = cost of the bat\n\n## Writing the Equations\n\n**Equation 1:** Together they cost $1.10\n$$bat + b = 1.10$$\n\n**Equation 2:** The bat costs $1 more than the ball\n$$bat = b + 1.00$$\n\n## Solving\n\nSubstituting Equation 2 into Equation 1:\n$$(b + 1.00) + b = 1.10$$\n$$2b + 1.00 = 1.10$$\n$$2b = 0.10$$\n$$b = 0.05$$\n\n## Answer\n\n**The ball costs $0.05 (5 cents).**\n\n*(The bat costs $1.05, and together they cost $1.10 \u2713)*\n\n> **Note:** The intuitive answer is 10 cents, but that's incorrect \u2014 if the ball cost 10\u00a2, the bat would cost $1.10, and together they'd cost $1.20, not $1.10.", "latency_ms": 4793, "input_tokens": 49, "output_tokens": 263 } ], "anthropic/claude-haiku-4-5": [ { "content": "# Step-by-Step Solution\n\nLet me define:\n- Ball cost = b\n- Bat cost = b + 1\n\n**Set up the equation:**\nb + (b + 1) = 1.10\n\n**Solve:**\n2b + 1 = 1.10\n2b = 0.10\nb = 0.05\n\n**Answer: The ball costs $0.05 (5 cents)**\n\n**Check:** \n- Ball: $0.05\n- Bat: $1.05\n- Total: $0.05 + $1.05 = $1.10 \u2713", "latency_ms": 1435, "input_tokens": 48, "output_tokens": 147 }, { "content": "# Solving Step by Step\n\nLet me define the variables:\n- Let b = cost of the ball\n- Let t = cost of the bat\n\n**Set up equations from the problem:**\n1. b + t = 1.10 (together they cost $1.10)\n2. t = b + 1.00 (bat costs $1 more than ball)\n\n**Substitute equation 2 into equation 1:**\n- b + (b + 1.00) = 1.10\n- 2b + 1.00 = 1.10\n- 2b = 0.10\n- b = 0.05\n\n**The ball costs $0.05 (5 cents)**\n\n*Check: Ball = $0.05, Bat = $1.05, Total = $1.10 \u2713*", "latency_ms": 1646, "input_tokens": 48, "output_tokens": 195 } ], "gemini/gemini-2.5-pro": [ { "content": "This is a classic brain teaser! Here's the step-by-step solution.\n\nLet's break it down:\n\n1. Let 'B' be the cost of the ball and 'A' be the cost of the bat.\n\n2. We know two things from the problem:\n * A + B = $1.10\n * A = B + $1.00 (The bat costs $1 more than the ball)\n\n3. Now, substitute the second equation into the first one:\n * (B + $1.00) + B = $1.10\n\n4. Simplify the equation:\n * 2B + $1.00 = $1.10\n\n5. Subtract $1.00 from both sides:\n * 2B = $0.10\n\n6. Divide by 2:\n * B = $0.05\n\nSo, the ball costs **$0.05** (or 5 cents).\n\n***\n\n**To check the answer:**\n* If the ball is $0.05...\n* ...and the bat costs $1.00 more, then the bat is $1.05.\n* Together, they cost $1.05 + $0.05 = **$1.10**. The math works out", "latency_ms": 10605, "input_tokens": 41, "output_tokens": 1309 }, { "content": "This is a classic brain teaser! Here's the step-by-step solution:\n\nThe ball costs **5 cents ($0.05)**.\n\n### Here's why:\n\n1. Let the cost of the ball be **X**.\n2. The bat costs $1.00 more than the ball, so the bat's cost is **X + $1.00**.\n3. Together, they cost $1.10. So, we can write the equation:\n **(Ball's cost) + (Bat's cost) = $1.10**\n **X + (X + $1.00) = $1.10**\n\n4. Now, solve the equation:\n * 2X + $1.00 = $1.10\n * 2X = $1.10 - $1.00\n * 2X = $0.10\n * X = $0.05\n\nSo, the ball costs **$0.05** (5 cents), and the bat costs **$1.05**.\n\n**Check the answer:** $1.05 (bat) + $0.05 (ball) = $1.10.", "latency_ms": 11138, "input_tokens": 41, "output_tokens": 1263 } ], "gemini/gemini-2.5-flash": [ { "content": "Let B be the cost of the bat and L be the cost of the ball.\n\nWe are given two pieces of information:\n\n1. Together, the bat and the ball cost $1.10:\n B + L = 1.10\n\n2. The bat costs $1 more than the ball:\n B = L + 1.00\n\nNow we can use substitution. Substitute the second equation into the first equation:\n\n(L + 1.00) + L = 1.10\n\nCombine the 'L' terms:\n\n2L + 1.00 = 1.10\n\nSubtract 1.00 from both sides of the equation:\n\n2L = 1.10 - 1.00\n2L = 0.10\n\nDivide by 2 to find the cost of the ball:\n\nL = 0.10 / 2\nL = 0.05\n\nSo, the ball costs $0.05.\n\nTo check:\nIf the ball costs $0.05, then the bat costs $0.05 + $1.00 = $1.05.\nTogether, $1.05 + $0.05 = $1.10. This matches the given information.\n\nThe ball costs **$0.05**.", "latency_ms": 4253, "input_tokens": 41, "output_tokens": 832 }, { "content": "Let B be the cost of the bat and L be the cost of the ball.\n\nWe are given two pieces of information:\n\n1. Together, they cost $1.10:\n B + L = 1.10\n\n2. The bat costs $1 more than the ball:\n B = L + 1.00\n\nNow we can substitute the second equation into the first one. Replace 'B' in the first equation with '(L + 1.00)':\n\n(L + 1.00) + L = 1.10\n\nCombine the 'L' terms:\n\n2L + 1.00 = 1.10\n\nSubtract 1.00 from both sides of the equation:\n\n2L = 1.10 - 1.00\n2L = 0.10\n\nDivide by 2 to find the cost of the ball:\n\nL = 0.10 / 2\nL = 0.05\n\nSo, the ball costs $0.05.\n\nLet's check:\nIf the ball is $0.05, the bat is $0.05 + $1.00 = $1.05.\nTogether, $1.05 + $0.05 = $1.10. This is correct.\n\nThe ball costs **$0.05**.", "latency_ms": 4038, "input_tokens": 41, "output_tokens": 853 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "spatial-1": { "prompt": "I'm facing north. I turn right. I turn right again. I turn left. What direction am I facing?", "category": "spatial", "responses": { "openai/gpt-5.4": [ { "content": "You start facing **north**.\n\n- Turn right \u2192 **east**\n- Turn right again \u2192 **south**\n- Turn left \u2192 **east**\n\n**Answer: East**", "latency_ms": 1487, "input_tokens": 43, "output_tokens": 37 }, { "content": "You start facing **north**.\n\n- Turn right \u2192 **east**\n- Turn right again \u2192 **south**\n- Turn left \u2192 **east**\n\n**Answer: East**", "latency_ms": 1547, "input_tokens": 43, "output_tokens": 37 } ], "openai/gpt-5.4-mini": [ { "content": "You end up facing **east**.\n\nStep by step:\n- Start facing **north**\n- Turn right \u2192 **east**\n- Turn right again \u2192 **south**\n- Turn left \u2192 **east**", "latency_ms": 662, "input_tokens": 43, "output_tokens": 43 }, { "content": "You end up facing **south**.\n\nStep by step:\n- Start facing **north**\n- Turn right \u2192 **east**\n- Turn right again \u2192 **south**\n- Turn left \u2192 **east**\n\nSo the final direction is **east**.", "latency_ms": 958, "input_tokens": 43, "output_tokens": 52 } ], "anthropic/claude-opus-4-6": [ { "content": "Let me trace through this step by step.\n\n1. **Start**: Facing **North**\n2. **Turn right**: Now facing **East**\n3. **Turn right again**: Now facing **South**\n4. **Turn left**: Now facing **East**\n\nYou are facing **East**.", "latency_ms": 2521, "input_tokens": 42, "output_tokens": 67 }, { "content": "Let me trace through each step:\n\n1. **Start**: Facing **North**\n2. **Turn right**: Now facing **East**\n3. **Turn right again**: Now facing **South**\n4. **Turn left**: Now facing **East**\n\nYou are facing **East**.", "latency_ms": 2655, "input_tokens": 42, "output_tokens": 65 } ], "anthropic/claude-sonnet-4-6": [ { "content": "Let me work through this step by step.\n\n1. **Starting**: Facing **North**\n2. **Turn right**: Facing **East**\n3. **Turn right again**: Facing **South**\n4. **Turn left**: Facing **East**\n\nYou are facing **East**.", "latency_ms": 1910, "input_tokens": 42, "output_tokens": 67 }, { "content": "Let me work through this step by step.\n\n1. **Starting**: Facing **North**\n2. **Turn right**: Facing **East**\n3. **Turn right again**: Facing **South**\n4. **Turn left**: Facing **East**\n\nYou are facing **East**.", "latency_ms": 1960, "input_tokens": 42, "output_tokens": 67 } ], "anthropic/claude-haiku-4-5": [ { "content": "# Step-by-step:\n\n1. **Starting position:** Facing north\n2. **Turn right:** North \u2192 East\n3. **Turn right again:** East \u2192 South\n4. **Turn left:** South \u2192 East\n\n**You are facing east.**", "latency_ms": 1038, "input_tokens": 41, "output_tokens": 58 }, { "content": "# Step-by-step:\n\n1. **Starting position:** Facing north\n\n2. **Turn right:** North \u2192 East\n\n3. **Turn right again:** East \u2192 South\n\n4. **Turn left:** South \u2192 East\n\n**You are facing east.**", "latency_ms": 10395, "input_tokens": 41, "output_tokens": 58 } ], "gemini/gemini-2.5-pro": [ { "content": "Let's break it down step-by-step:\n\n1. You start facing **North**.\n2. You turn right, so you are now facing **East**.\n3. You turn right again, so you are now facing **South**.\n4. You turn left, so you are now facing **East**.\n\nYou are facing **East**.", "latency_ms": 4419, "input_tokens": 36, "output_tokens": 485 }, { "content": "Let's break it down step-by-step:\n\n1. You start facing **North**.\n2. You turn right, so now you are facing **East**.\n3. You turn right again, so now you are facing **South**.\n4. You turn left, so now you are facing **East**.\n\nYou are facing **East**.", "latency_ms": 4386, "input_tokens": 36, "output_tokens": 433 } ], "gemini/gemini-2.5-flash": [ { "content": "Let's break it down step by step:\n\n1. **Start:** You are facing **North**.\n2. **Turn right:** From North, a right turn puts you facing **East**.\n3. **Turn right again:** From East, a right turn puts you facing **South**.\n4. **Turn left:** From South, a left turn puts you facing **East**.\n\nYou are facing **East**.", "latency_ms": 1668, "input_tokens": 36, "output_tokens": 235 }, { "content": "Let's break it down step by step:\n\n1. **Start:** Facing North\n2. **Turn Right:** Now facing East\n3. **Turn Right again:** Now facing South\n4. **Turn Left:** Now facing East\n\nYou are facing **East**.", "latency_ms": 1692, "input_tokens": 36, "output_tokens": 245 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "causality-1": { "prompt": "A man pushes his car to a hotel and loses his fortune. What happened?", "category": "causality", "responses": { "openai/gpt-5.4": [ { "content": "He\u2019s playing Monopoly.\n\nHe pushed his car token to a hotel space, landed on it, and had to pay so much rent that he lost his fortune.", "latency_ms": 1784, "input_tokens": 36, "output_tokens": 35 }, { "content": "He\u2019s playing **Monopoly**.\n\n- He \u201cpushes his car\u201d = moves the **car token**\n- He arrives at a **hotel**\n- He \u201closes his fortune\u201d = has to pay so much rent that he goes broke\n\nSo it\u2019s not a real car or hotel\u2014it\u2019s a board game.", "latency_ms": 1956, "input_tokens": 36, "output_tokens": 69 } ], "openai/gpt-5.4-mini": [ { "content": "He was playing **Monopoly**.\n\nHe \u201cpushed his car\u201d by landing on or moving the **car token** to **Hotel**, and \u201clost his fortune\u201d because he paid rent to a hotel and went bankrupt.", "latency_ms": 917, "input_tokens": 36, "output_tokens": 49 }, { "content": "He was playing **Monopoly**.\n\nIn the game, \u201cgo to the hotel\u201d / landing on a hotel can cost you a lot of money, and \u201closes his fortune\u201d means he went bankrupt\u2014not that it happened in real life.", "latency_ms": 915, "input_tokens": 36, "output_tokens": 53 } ], "anthropic/claude-opus-4-6": [ { "content": "This is a classic riddle! Let me think through it step by step:\n\n- **Pushing a car** \u2013 This doesn't have to mean a real automobile.\n- **A hotel** \u2013 This doesn't have to mean a real building.\n- **Loses his fortune** \u2013 Something causes him to go broke.\n\nThe answer: **He's playing Monopoly!**\n\nIn the board game Monopoly, you move a game piece (sometimes a little car token) along the board. When you land on a space with someone else's hotel, you have to pay a huge rent \u2014 which can bankrupt you and wipe out your fortune.", "latency_ms": 6086, "input_tokens": 35, "output_tokens": 141 }, { "content": "This is a classic riddle! Let me think through it step by step.\n\nThe key is that this isn't describing a real-life situation on a road \u2014 it's describing a **board game**.\n\n**He's playing Monopoly.**\n\n- He lands on a property with a hotel on it.\n- He \"pushes his car\" (the car-shaped game piece) to that space.\n- He has to pay the expensive rent for landing on a property with a hotel, which causes him to lose his fortune (go bankrupt).", "latency_ms": 4584, "input_tokens": 35, "output_tokens": 118 } ], "anthropic/claude-sonnet-4-6": [ { "content": "This is a classic lateral thinking puzzle / riddle.\n\nThe answer is: **He was playing Monopoly.**\n\nHe pushed his **Monopoly car token** to the **hotel** that was on the property, and had to pay rent \u2014 which wiped out all his money (his \"fortune\").", "latency_ms": 2382, "input_tokens": 35, "output_tokens": 67 }, { "content": "This is a classic lateral thinking puzzle / riddle.\n\nThe answer is: **He's playing Monopoly.**\n\nHe pushed his **toy car** (the car token) to the **hotel** on the board, which was owned by another player, and had to pay the rent \u2014 which wiped out all his money (his \"fortune\").", "latency_ms": 2610, "input_tokens": 35, "output_tokens": 75 } ], "anthropic/claude-haiku-4-5": [ { "content": "# The Answer\n\nThis is a classic riddle! The man was playing **Monopoly**.\n\nWhen you push your game piece (car) to a hotel on the board in Monopoly, you have to pay rent to the property owner, which can cost a lot of money and cause you to lose the game (your fortune in the game).", "latency_ms": 1625, "input_tokens": 34, "output_tokens": 75 }, { "content": "# The Answer\n\nThis is a riddle! The man lost his fortune because he was playing **Monopoly** (the board game).\n\nIn Monopoly:\n- Players move their pieces around the board by pushing/rolling a die\n- Landing on properties and paying rent causes you to lose money\n- Players can lose their fortune (all their money) during the game\n- The \"hotel\" is a key property upgrade in the game that costs a lot of money and generates high rent payments\n\nSo he pushed his game piece (car token) toward the hotel property and had to pay so much rent that he went bankrupt!", "latency_ms": 2436, "input_tokens": 34, "output_tokens": 134 } ], "gemini/gemini-2.5-pro": [ { "content": "This is a classic riddle! Here's the step-by-step solution:\n\n**He was playing Monopoly.**\n\n* **The \"man\"** is a player in the board game.\n* **His \"car\"** is the little metal or plastic game token.\n* **He \"pushes\" his car** around the board after rolling the dice.\n* He lands on a property, like Boardwalk, where another player has built a **\"hotel\"**.\n* The rent is so high that he can't afford to pay it, so he goes bankrupt and **\"loses his fortune.\"**", "latency_ms": 9582, "input_tokens": 27, "output_tokens": 1071 }, { "content": "This is a classic riddle! Here's the solution:\n\nHe was playing the board game **Monopoly**.\n\n* His \"car\" was his playing piece.\n* He landed on an opponent's property (like Boardwalk or Park Place) that had a \"hotel\" on it.\n* The rent was so high that it bankrupted him, and he lost all his game money\u2014his \"fortune.\"", "latency_ms": 9741, "input_tokens": 27, "output_tokens": 967 } ], "gemini/gemini-2.5-flash": [ { "content": "He was playing **Monopoly!**\n\nHe moved his \"car\" playing piece to a property with a \"hotel\" on it and had to pay a huge amount of rent, losing his \"fortune\" in the game.", "latency_ms": 6879, "input_tokens": 27, "output_tokens": 1050 }, { "content": "The man was playing **Monopoly**!\n\n* He \"pushes his car\" (his game token).\n* He lands on a property with a \"hotel\" on it.\n* He has to pay a huge amount of rent, causing him to \"lose his fortune\" (go bankrupt in the game).", "latency_ms": 4772, "input_tokens": 27, "output_tokens": 731 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "code-1": { "prompt": "What does this function return for input 5? def f(n): return n if n <= 1 else f(n-1) + f(n-2)", "category": "code", "responses": { "openai/gpt-5.4": [ { "content": "For input `5`, the function returns **5**.\n\nIt\u2019s the Fibonacci sequence:\n\n- `f(5) = f(4) + f(3)`\n- `f(4) = f(3) + f(2)`\n- `f(3) = f(2) + f(1)`\n- `f(2) = f(1) + f(0)`\n- base cases: `f(1)=1`, `f(0)=0`\n\nSo:\n\n- `f(2)=1`\n- `f(3)=2`\n- `f(4)=3`\n- `f(5)=5`\n\n**Answer: 5**", "latency_ms": 2707, "input_tokens": 53, "output_tokens": 143 }, { "content": "The function computes the Fibonacci sequence:\n\n- `f(0) = 0`\n- `f(1) = 1`\n- `f(2) = 1`\n- `f(3) = 2`\n- `f(4) = 3`\n- `f(5) = 5`\n\nSo for input `5`, it returns **5**.", "latency_ms": 1653, "input_tokens": 53, "output_tokens": 82 } ], "openai/gpt-5.4-mini": [ { "content": "For `n = 5`, the function returns **5**.\n\nIt defines the Fibonacci sequence with base cases:\n\n- `f(0) = 0`\n- `f(1) = 1`\n\nSo the values go:\n\n- `f(2) = 1`\n- `f(3) = 2`\n- `f(4) = 3`\n- `f(5) = 5`\n\nTherefore, **`f(5) == 5`**.", "latency_ms": 1060, "input_tokens": 53, "output_tokens": 105 }, { "content": "For input `5`, the function returns **`5`**.\n\nThis is the Fibonacci sequence:\n\n- `f(0) = 0`\n- `f(1) = 1`\n- `f(2) = 1`\n- `f(3) = 2`\n- `f(4) = 3`\n- `f(5) = 5`\n\nSo:\n\n```python\nf(5) == 5\n```", "latency_ms": 948, "input_tokens": 53, "output_tokens": 97 } ], "anthropic/claude-opus-4-6": [ { "content": "# Tracing the Recursive Function\n\nThis is the classic **Fibonacci sequence** function. Let me trace through it step by step for `f(5)`:\n\n## Step-by-step evaluation:\n\n**Base cases:**\n- `f(0)` = 0 (since 0 \u2264 1)\n- `f(1)` = 1 (since 1 \u2264 1)\n\n**Recursive calls:**\n- `f(2)` = f(1) + f(0) = 1 + 0 = **1**\n- `f(3)` = f(2) + f(1) = 1 + 1 = **2**\n- `f(4)` = f(3) + f(2) = 2 + 1 = **3**\n- `f(5)` = f(4) + f(3) = 3 + 2 = **5**\n\n## Answer: **5**\n\nThe function returns `5` for input `5`. It computes the nth Fibonacci number (0, 1, 1, 2, 3, **5**, 8, 13, ...).", "latency_ms": 5485, "input_tokens": 55, "output_tokens": 279 }, { "content": "# Tracing the Recursive Function\n\nThis is the classic **Fibonacci sequence** implementation. Let me trace through it step by step for `f(5)`:\n\n## Step-by-step evaluation:\n\n```\nf(5) = f(4) + f(3)\n\nf(4) = f(3) + f(2)\nf(3) = f(2) + f(1)\n\nf(2) = f(1) + f(0)\nf(1) = 1 (base case: n <= 1)\nf(0) = 0 (base case: n <= 1)\n```\n\n## Building back up:\n\n| Call | Result |\n|------|--------|\n| f(0) | 0 |\n| f(1) | 1 |\n| f(2) | f(1) + f(0) = 1 + 0 = **1** |\n| f(3) | f(2) + f(1) = 1 + 1 = **2** |\n| f(4) | f(3) + f(2) = 2 + 1 = **3** |\n| f(5) | f(4) + f(3) = 3 + 2 = **5** |\n\n## The function returns **5**.\n\nThis produces the Fibonacci sequence: 0, 1, 1, 2, 3, **5**, 8, 13, ...", "latency_ms": 5810, "input_tokens": 55, "output_tokens": 344 } ], "anthropic/claude-sonnet-4-6": [ { "content": "## Step-by-step Trace\n\nThis is the **Fibonacci sequence** function. Let me trace through `f(5)`:\n\n```\nf(5) = f(4) + f(3)\nf(4) = f(3) + f(2)\nf(3) = f(2) + f(1)\nf(2) = f(1) + f(0)\n = 1 + 0 = 1\nf(3) = 1 + 1 = 2\nf(4) = 2 + 1 = 3\nf(3) = 2 (already calculated)\nf(5) = 3 + 2 = 5\n```\n\n## Result\n\n`f(5)` returns **5**", "latency_ms": 3384, "input_tokens": 55, "output_tokens": 184 }, { "content": "## Step-by-Step Trace\n\nThis is a recursive **Fibonacci** function. Let me trace it for `n = 5`:\n\n```\nf(5) = f(4) + f(3)\nf(4) = f(3) + f(2)\nf(3) = f(2) + f(1)\nf(2) = f(1) + f(0)\n = 1 + 0 = 1\nf(3) = 1 + 1 = 2\nf(4) = 2 + 1 = 3 \u2190 f(2) = 1\nf(3) = 2 \u2190 (calculated above)\nf(5) = 3 + 2 = 5\n```\n\n## Result\n\n**`f(5)` returns `5`**", "latency_ms": 3330, "input_tokens": 55, "output_tokens": 199 } ], "anthropic/claude-haiku-4-5": [ { "content": "# Step-by-step trace of f(5)\n\nThis is the Fibonacci function. Let me trace through the recursive calls:\n\n**f(5)** = f(4) + f(3)\n\n**f(4)** = f(3) + f(2)\n**f(3)** = f(2) + f(1)\n\n**f(2)** = f(1) + f(0)\n**f(1)** = 1 (base case)\n**f(0)** = 0 (base case)\n\nNow working back up:\n- f(2) = 1 + 0 = **1**\n- f(3) = 1 + 1 = **2**\n- f(4) = 2 + 1 = **3**\n- f(5) = 3 + 2 = **5**\n\n**The function returns 5**", "latency_ms": 1683, "input_tokens": 54, "output_tokens": 215 }, { "content": "# Step-by-Step Execution\n\nThis is a recursive function that computes Fibonacci numbers. Let me trace through `f(5)`:\n\n```\nf(5) = f(4) + f(3)\n f(4) = f(3) + f(2)\n f(3) = f(2) + f(1)\n f(2) = f(1) + f(0)\n f(1) = 1\n f(0) = 0\n f(2) = 1 + 0 = 1\n f(3) = 1 + 1 = 2\n f(4) = 2 + 1 = 3\nf(5) = 3 + 2 = 5\n```\n\n**The function returns `5`**\n\nThis matches the Fibonacci sequence: 0, 1, 1, 2, 3, 5, 8, 13...", "latency_ms": 1561, "input_tokens": 54, "output_tokens": 227 } ], "gemini/gemini-2.5-pro": [ { "content": "Let's trace the execution of the function `f(5)` step by step.\n\nThe function is defined as:\n`def f(n): return n if n <= 1 else f(n-1) + f(n-2)`\n\nThis is a recursive function that calculates the nth Fibonacci number.\n\n1. **`f(5)` is called.**\n * Since 5 is not <= 1, it will return `f(5-1) + f(5-2)`, which is `f(4) + f(3)`.\n\n2. **Now we need to calculate `f(4)` and `f(3)`.**\n * **To calculate `f(4)`:**\n * Since 4 is not <= 1, it returns `f(3) + f(2)`.\n * **To calculate `f(3)`:**\n * Since 3 is not <= 1, it returns `f(2) + f(1)`.\n\n3. **We need to break it down further until we reach the base cases (`n <= 1`).**\n * **To calculate `f(2)`:**\n * Since 2 is not <= 1, it returns `f(1) + f(0)`.\n * **To calculate `f(1)`:**\n * Since 1 is <= 1, it hits the base case and returns `1`.\n * **To calculate `f(0)`:**\n * Since 0 is <= 1, it hits the base case and returns `0`.\n\n4. **Now, we can substitute the results back up the chain:**\n * `f(2)` = `f(1)` + `f(0)` = `1 + 0` = **1**\n * `f(3)` = `f(2)` + `f(1)` = `1 + 1` = **2**\n * `f(4)` = `f(3)` + `f(2)` = `2 + 1` = **3**\n * `f(5)` = `f(4)` + `f(3)` = `3 + 2` = **5**\n\nTherefore, the function returns **5** for the input 5.", "latency_ms": 11357, "input_tokens": 47, "output_tokens": 1455 }, { "content": "Excellent question. Let's break down the execution of this function step by step.\n\nThe function is a classic recursive implementation of the Fibonacci sequence.\n\n```python\ndef f(n):\n return n if n <= 1 else f(n-1) + f(n-2)\n```\n\nHere's how it calculates `f(5)`:\n\n1. **`f(5)` is called.**\n * Since 5 is not <= 1, it must compute `f(4) + f(3)`.\n\n2. To do that, it first needs to compute **`f(4)`**.\n * Since 4 is not <= 1, it must compute `f(3) + f(2)`.\n\n3. To do that, it first needs to compute **`f(3)`**.\n * Since 3 is not <= 1, it must compute `f(2) + f(1)`.\n\n4. To do that, it first needs to compute **`f(2)`**.\n * Since 2 is not <= 1, it must compute `f(1) + f(0)`.\n * `f(1)` is called. Since 1 <= 1, it hits the base case and **returns 1**.\n * `f(0)` is called. Since 0 <= 1, it hits the base case and **returns 0**.\n * Now `f(2)` can complete: `1 + 0 = 1`. So, **`f(2)` returns 1**.\n\n5. Now we can go back to calculating `f(3)`.\n * We know `f(3) = f(2) + f(1)`.\n * We just found `f(2)` is 1.\n * `f(1)` is called again, which **returns 1** (base case).\n * So, `f(3) = 1 + 1 = 2`. **`f(3)` returns 2**.\n\n6. Now we can go back to calculating `f(4)`.\n * We know `f(4) = f(3) + f(2)`.\n * We just found `f(3)` is 2.\n * We already calculated `f(2)` as 1.\n * So, `f(4) = 2 + 1 = 3`. **`f(4)` returns 3**.\n\n7. Finally, we can go back to the original call, `f(5)`.\n * We know `f(5) = f(4) + f(3)`.\n * We just found `f(4)` is 3.\n * We already calculated `f(3)` as 2.\n * So, `f(5) = 3 + 2 = 5`.\n\nThe function returns **5**.", "latency_ms": 16387, "input_tokens": 47, "output_tokens": 2290 } ], "gemini/gemini-2.5-flash": [ { "content": "Let's trace the execution of the function `f(n)` for input `n=5` step by step.\n\nThe function is defined as:\n```python\ndef f(n):\n return n if n <= 1 else f(n-1) + f(n-2)\n```\n\n1. **f(5)**:\n * Is `5 <= 1`? No.\n * So, it returns `f(4) + f(3)`\n\n2. Let's calculate **f(4)**:\n * Is `4 <= 1`? No.\n * So, it returns `f(3) + f(2)`\n\n3. Let's calculate **f(3)** (needed for both f(5) and f(4)):\n * Is `3 <= 1`? No.\n * So, it returns `f(2) + f(1)`\n\n4. Let's calculate **f(2)** (needed for f(4) and f(3)):\n * Is `2 <= 1`? No.\n * So, it returns `f(1) + f(0)`\n\n5. Let's calculate **f(1)** (needed for f(3) and f(2)):\n * Is `1 <= 1`? Yes.\n * It returns `1`.\n\n6. Let's calculate **f(0)** (needed for f(2)):\n * Is `0 <= 1`? Yes.\n * It returns `0`.\n\nNow, we can substitute the values back up:\n\n* **f(2)** = `f(1)` + `f(0)` = `1` + `0` = `1`\n* **f(3)** = `f(2)` + `f(1)` = `1` + `1` = `2`\n* **f(4)** = `f(3)` + `f(2)` = `2` + `1` = `3`\n* **f(5)** = `f(4)` + `f(3)` = `3` + `2` = `5`\n\nThis function calculates the Fibonacci sequence where F(0)=0, F(1)=1, F(n)=F(n-1)+F(n-2).\n\nThe function returns **5** for input 5.", "latency_ms": 8231, "input_tokens": 47, "output_tokens": 1801 }, { "content": "The given function `f(n)` is a recursive function defined as:\n- If `n <= 1`, `f(n)` returns `n`.\n- If `n > 1`, `f(n)` returns `f(n-1) + f(n-2)`.\n\nThis is a classic recursive definition that computes the Fibonacci sequence. Let's trace the execution for `n = 5`:\n\n1. **f(5)**: Since `5 > 1`, it calls `f(4) + f(3)`.\n * To calculate `f(4)`:\n * **f(4)**: Since `4 > 1`, it calls `f(3) + f(2)`.\n * To calculate `f(3)`:\n * **f(3)**: Since `3 > 1`, it calls `f(2) + f(1)`.\n * To calculate `f(2)`:\n * **f(2)**: Since `2 > 1`, it calls `f(1) + f(0)`.\n * **f(1)**: Since `1 <= 1`, it returns `1`.\n * **f(0)**: Since `0 <= 1`, it returns `0`.\n * So, `f(2)` returns `1 + 0 = 1`.\n * **f(1)**: Since `1 <= 1`, it returns `1`.\n * So, `f(3)` returns `1 + 1 = 2`.\n * **f(2)**: We already calculated this, it returns `1`.\n * So, `f(4)` returns `2 + 1 = 3`.\n * To calculate `f(3)`: We already calculated this, it returns `2`.\n\n2. Finally, **f(5)** returns `f(4) + f(3) = 3 + 2 = 5`.\n\nLet's list the values calculated:\nf(0) = 0 (base case)\nf(1) = 1 (base case)\nf(2) = f(1) + f(0) = 1 + 0 = 1\nf(3) = f(2) + f(1) = 1 + 1 = 2\nf(4) = f(3) + f(2) = 2 + 1 = 3\nf(5) = f(4) + f(3) = 3 + 2 = 5\n\nThe function returns **5** for input 5.", "latency_ms": 6949, "input_tokens": 47, "output_tokens": 1444 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "ambiguity-1": { "prompt": "The trophy doesn't fit in the suitcase because it's too big. What is too big?", "category": "ambiguity", "responses": { "openai/gpt-5.4": [ { "content": "\u201cToo big\u201d refers to **the trophy**.\n\nReason: If the trophy doesn\u2019t fit in the suitcase because **it\u2019s too big**, the thing that is too big is the object trying to go inside the suitcase.", "latency_ms": 1529, "input_tokens": 37, "output_tokens": 48 }, { "content": "\u201cToo big\u201d refers to **the trophy**.\n\nReason: If the trophy doesn\u2019t fit in the suitcase because it\u2019s too big, the thing that is too big must be the object trying to go inside \u2014 the trophy.", "latency_ms": 1392, "input_tokens": 37, "output_tokens": 49 } ], "openai/gpt-5.4-mini": [ { "content": "\u201cToo big\u201d refers to **the trophy**.", "latency_ms": 934, "input_tokens": 37, "output_tokens": 14 }, { "content": "The **trophy** is too big.", "latency_ms": 513, "input_tokens": 37, "output_tokens": 12 } ], "anthropic/claude-opus-4-6": [ { "content": "Let me think through this step by step.\n\nThe sentence is: \"The trophy doesn't fit in the suitcase because it's too big.\"\n\nThe question is what \"it\" refers to \u2014 what is too big?\n\nIf the **suitcase** were too big, that wouldn't explain why the trophy doesn't fit. A bigger suitcase would make it *easier* to fit the trophy.\n\nIf the **trophy** is too big, that logically explains why it doesn't fit in the suitcase.\n\nTherefore, **the trophy** is too big.", "latency_ms": 3504, "input_tokens": 39, "output_tokens": 125 }, { "content": "Let me think through this step by step.\n\nThe sentence is: \"The trophy doesn't fit in the suitcase because it's too big.\"\n\nThe question is what \"it\" refers to \u2014 what is too big?\n\nIf the **suitcase** were too big, that wouldn't explain why the trophy doesn't fit. A bigger suitcase would make it *easier* to fit the trophy.\n\nIf the **trophy** is too big, that logically explains why it doesn't fit in the suitcase.\n\nTherefore, **the trophy** is too big.", "latency_ms": 3258, "input_tokens": 39, "output_tokens": 125 } ], "anthropic/claude-sonnet-4-6": [ { "content": "In this sentence, **\"it\"** refers to **the trophy**.\n\nThe trophy is too big to fit in the suitcase. The pronoun \"it\" logically refers to the trophy, since it is the trophy that is too large to fit \u2014 not the suitcase (if the suitcase were too big, that wouldn't prevent the trophy from fitting inside it).", "latency_ms": 2604, "input_tokens": 39, "output_tokens": 83 }, { "content": "The word \"it's\" in this sentence refers to **the trophy**. The trophy is too big to fit in the suitcase.", "latency_ms": 1606, "input_tokens": 39, "output_tokens": 32 } ], "anthropic/claude-haiku-4-5": [ { "content": "# The Trophy\n\nThe **trophy** is too big. \n\nThe sentence structure indicates that \"it\" refers to the trophy (the subject of the sentence), meaning the trophy is too large to fit inside the suitcase.", "latency_ms": 945, "input_tokens": 38, "output_tokens": 50 }, { "content": "# The Trophy\n\nThe **trophy** is too big.\n\nThe pronoun \"it's\" refers to the trophy, which is the subject of the sentence. The trophy doesn't fit in the suitcase because the trophy is too big (for the suitcase).", "latency_ms": 857, "input_tokens": 38, "output_tokens": 59 } ], "gemini/gemini-2.5-pro": [ { "content": "Based on the sentence, **the trophy** is too big.", "latency_ms": 6015, "input_tokens": 32, "output_tokens": 582 }, { "content": "Based on that sentence, **the trophy** is too big.\n\nHere's the step-by-step logic:\n\n1. The sentence states a cause and effect: The trophy doesn't fit (effect) **because** \"it's\" too big (cause).\n2. The pronoun \"it\" refers to one of the two objects: the trophy or the suitcase.\n3. If \"it\" referred to the suitcase (\"the suitcase is too big\"), then the trophy would easily fit.\n4. Therefore, \"it\" must refer to **the trophy**. The trophy is too big to fit into the suitcase.", "latency_ms": 5476, "input_tokens": 32, "output_tokens": 618 } ], "gemini/gemini-2.5-flash": [ { "content": "**The trophy** is too big.", "latency_ms": 1936, "input_tokens": 32, "output_tokens": 261 }, { "content": "The **trophy** is too big.", "latency_ms": 1848, "input_tokens": 32, "output_tokens": 259 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } }, "common-sense-1": { "prompt": "How many times can you subtract 5 from 25?", "category": "common_sense", "responses": { "openai/gpt-5.4": [ { "content": "Only **once**.\n\nAfter you subtract 5 from 25 the first time, you\u2019re no longer subtracting 5 from **25** \u2014 you\u2019re subtracting it from **20**.", "latency_ms": 1331, "input_tokens": 32, "output_tokens": 43 }, { "content": "Only once.\n\nAfter you subtract 5 from 25 the first time, you\u2019re no longer subtracting from 25 \u2014 you\u2019re subtracting from 20.", "latency_ms": 1121, "input_tokens": 32, "output_tokens": 36 } ], "openai/gpt-5.4-mini": [ { "content": "You can subtract 5 from 25 **once**.\n\nAfter that, you\u2019re subtracting from 20, then 15, and so on. \nThis is a trick question: **only the first subtraction is \u201csubtract 5 from 25.\u201d**", "latency_ms": 814, "input_tokens": 32, "output_tokens": 56 }, { "content": "Once.\n\nAfter you subtract 5 from 25, you get 20, so you can\u2019t keep subtracting 5 from the original 25.", "latency_ms": 641, "input_tokens": 32, "output_tokens": 34 } ], "anthropic/claude-opus-4-6": [ { "content": "This is a classic trick question! Let me think through it carefully.\n\n**The answer is 1 time.**\n\nHere's why: You can only subtract 5 from **25** once. After that, you're no longer subtracting 5 from 25 \u2014 you're subtracting 5 from **20**, then from **15**, and so on.\n\nSo while you can perform the operation of subtracting 5 repeatedly (25 \u2192 20 \u2192 15 \u2192 10 \u2192 5 \u2192 0), you can only subtract 5 from **25** exactly **once**.", "latency_ms": 3823, "input_tokens": 31, "output_tokens": 138 }, { "content": "This is a classic trick question! Let me think through it carefully.\n\n**The answer is once.**\n\nThe first time you subtract 5 from 25, you get 20. After that, you're no longer subtracting 5 from **25** \u2014 you'd be subtracting 5 from **20**, then from **15**, and so on.\n\nSo you can only subtract 5 from **25** exactly **one time**.", "latency_ms": 3059, "input_tokens": 31, "output_tokens": 100 } ], "anthropic/claude-sonnet-4-6": [ { "content": "Let me think about this step by step.\n\n- 25 - 5 = 20 (1st time)\n- 20 - 5 = 15 (2nd time)\n- 15 - 5 = 10 (3rd time)\n- 10 - 5 = 5 (4th time)\n- 5 - 5 = 0 (5th time)\n\nYou can subtract 5 from 25 **5 times**.\n\n*(Though there's a classic trick answer: only **once**, because after that you're subtracting from 20, then 15, etc. \u2014 not from 25 anymore!)*", "latency_ms": 3295, "input_tokens": 31, "output_tokens": 159 }, { "content": "Let me think about this step by step.\n\n- 25 - 5 = 20\n- 20 - 5 = 15\n- 15 - 5 = 10\n- 10 - 5 = 5\n- 5 - 5 = 0\n\nYou can subtract 5 from 25 exactly **5 times**.", "latency_ms": 2046, "input_tokens": 31, "output_tokens": 89 } ], "anthropic/claude-haiku-4-5": [ { "content": "# Subtracting 5 from 25\n\nYou can subtract 5 from 25 **five times**:\n\n- 25 - 5 = 20\n- 20 - 5 = 15\n- 15 - 5 = 10\n- 10 - 5 = 5\n- 5 - 5 = 0\n\nAfter the fifth subtraction, you reach 0 and can't subtract 5 anymore (without going negative).", "latency_ms": 1124, "input_tokens": 30, "output_tokens": 115 }, { "content": "# Subtracting 5 from 25\n\nIf you subtract 5 repeatedly from 25:\n- 25 - 5 = 20\n- 20 - 5 = 15\n- 15 - 5 = 10\n- 10 - 5 = 5\n- 5 - 5 = 0\n\nYou can subtract 5 from 25 exactly **5 times** before reaching 0.\n\n(This is the same as dividing: 25 \u00f7 5 = 5)", "latency_ms": 1131, "input_tokens": 30, "output_tokens": 132 } ], "gemini/gemini-2.5-pro": [ { "content": "This is a classic riddle! Here are the two ways to answer it:\n\n**The Literal Answer:**\n\nYou can only subtract 5 from 25 **once**.\n\nAfter you subtract 5 for the first time, the number is no longer 25, it's 20. So, you can't subtract 5 from 25 again.\n\n***\n\n**The Mathematical Answer:**\n\nIf the question means \"How many times can you subtract 5 from 25 until you get to zero?\", the answer is **5** times.\n\n* 25 - 5 = 20 (1st time)\n* 20 - 5 = 15 (2nd time)\n* 15 - 5 = 10 (3rd time)\n* 10 - 5 = 5 (4th time)\n* 5 - 5 = 0 (5th time)", "latency_ms": 8667, "input_tokens": 24, "output_tokens": 1017 }, { "content": "This is a classic riddle! The answer depends on how you interpret the question.\n\n**The Riddle Answer:**\n\nYou can only subtract 5 from 25 **once**.\n\nAfter you subtract 5 the first time, you are no longer subtracting from 25; you are subtracting from 20.\n\n***\n\n**The Mathematical Answer:**\n\nIf the question is \"How many times must you subtract 5 from 25 to reach 0?\", the answer is **5 times**.\n\n1. 25 - 5 = 20\n2. 20 - 5 = 15\n3. 15 - 5 = 10\n4. 10 - 5 = 5\n5. 5 - 5 = 0", "latency_ms": 7500, "input_tokens": 24, "output_tokens": 876 } ], "gemini/gemini-2.5-flash": [ { "content": "This is a bit of a trick question!\n\nYou can subtract 5 from 25 **one time**.\n\nAfter you subtract 5 from 25, you are left with 20. You can no longer \"subtract 5 from 25\" because 25 isn't there anymore. You would then be subtracting 5 from 20.\n\nIf the question were \"How many times can you subtract 5 from 25 *until you reach zero*?\" then the answer would be 5 times (25 - 5 = 20, 20 - 5 = 15, 15 - 5 = 10, 10 - 5 = 5, 5 - 5 = 0).", "latency_ms": 3693, "input_tokens": 24, "output_tokens": 654 }, { "content": "This is a classic riddle!\n\n* **Mathematically**, you can subtract 5 from 25 a total of **5 times** until you reach zero:\n * 25 - 5 = 20\n * 20 - 5 = 15\n * 15 - 5 = 10\n * 10 - 5 = 5\n * 5 - 5 = 0\n\n* **However, as a riddle**, the answer is **once**. After you subtract 5 from 25, the number is no longer 25; it's 20. So, you can only subtract 5 from the number \"25\" one time.", "latency_ms": 5306, "input_tokens": 24, "output_tokens": 697 } ], "ollama/llama3": [ { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" }, { "error": "litellm.APIConnectionError: OllamaException - [Errno 111] Connection refused" } ] } } } }